Products 2365471-11-8
CAS 2365471-11-8 appears in our catalog under these names: 4–fluoro ADB, 4-Fluoro adb. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
Methyl (2S)-2-[[1-(4-fluoropentyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoate (CAS 2365471-11-8) is a chemical compound with the molecular formula C20H28FN3O3 and a molecular weight of 377.5 g/mol. IUPAC name: methyl (2S)-2-[[1-(4-fluoropentyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoate. InChIKey: UVZIIUNEZHXUMY-LRHAYUFXSA-N.
| Molecular formula | C20H28FN3O3 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | methyl (2S)-2-[[1-(4-fluoropentyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
| InChIKey | UVZIIUNEZHXUMY-LRHAYUFXSA-N |
| SMILES | CC(CCCN1C2=CC=CC=C2C(=N1)C(=O)N[C@H](C(=O)OC)C(C)(C)C)F |
Computed by PubChem (NCBI)