CAS 2368844-67-9 is the registry number for 6-Bromo-4-(trifluoromethyl)isoindolin-1-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one (CAS 2368844-67-9) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 6-bromo-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one. InChIKey: RDKNDBGCYPYGJK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 6-bromo-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | RDKNDBGCYPYGJK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2C(F)(F)F)Br)C(=O)N1 |
Computed by PubChem (NCBI)