CAS 2368903-83-5 is the registry number for 4-(3-(pyridin-4-yl)phenyl)thiazol-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-amine (CAS 2368903-83-5) is a chemical compound with the molecular formula C14H11N3S and a molecular weight of 253.32 g/mol. IUPAC name: 4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-amine. InChIKey: PUGYTTVEMKCKOI-UHFFFAOYSA-N.
| Molecular formula | C14H11N3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-amine |
| InChIKey | PUGYTTVEMKCKOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CSC(=N2)N)C3=CC=NC=C3 |
Computed by PubChem (NCBI)