CAS 2369894-99-3 is the registry number for Oseltamivir Impurity 121. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R,5S)-4-[acetyl(tert-butyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 2369894-99-3) is a chemical compound with the molecular formula C20H36N2O4 and a molecular weight of 368.5 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-[acetyl(tert-butyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: HBXRSMTXACKEIT-RCCFBDPRSA-N.
| Molecular formula | C20H36N2O4 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-[acetyl(tert-butyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | HBXRSMTXACKEIT-RCCFBDPRSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N(C(=O)C)C(C)(C)C)N)C(=O)OCC |
Computed by PubChem (NCBI)