CAS 2369981-30-4 is the registry number for 4'-([2,2':6',2''-Terpyridin]-4'-yl)-[1,1'-biphenyl]-3,5-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]benzene-1,3-dicarboxylic acid (CAS 2369981-30-4) is a chemical compound with the molecular formula C29H19N3O4 and a molecular weight of 473.5 g/mol. IUPAC name: 5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: KVUKCSCUYGYAIH-UHFFFAOYSA-N.
| Molecular formula | C29H19N3O4 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | KVUKCSCUYGYAIH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)C5=CC(=CC(=C5)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)