Products 2370026-60-9
CAS 2370026-60-9 is the registry number for 2-(Difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-(difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2370026-60-9) is a chemical compound with the molecular formula C13H18BF2NO3 and a molecular weight of 285.10 g/mol. IUPAC name: 2-(difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: URPGGYHLDDHMLE-UHFFFAOYSA-N.
| Molecular formula | C13H18BF2NO3 |
|---|---|
| Molecular weight | 285.10 g/mol |
| IUPAC name | 2-(difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | URPGGYHLDDHMLE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)OC(F)F |
Computed by PubChem (NCBI)