Products 2379241-80-0
CAS 2379241-80-0 is the registry number for (R)-4-Bromo-1-[1-[(tert-butyldimethylsilyl)oxy]-2-propyl]-1H-pyrazole, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[(2R)-2-(4-bromopyrazol-1-yl)propoxy]-tert-butyl-dimethylsilane (CAS 2379241-80-0) is a chemical compound with the molecular formula C12H23BrN2OSi and a molecular weight of 319.31 g/mol. IUPAC name: [(2R)-2-(4-bromopyrazol-1-yl)propoxy]-tert-butyl-dimethylsilane. InChIKey: OFGDKZJOUCIMGF-SNVBAGLBSA-N.
| Molecular formula | C12H23BrN2OSi |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | [(2R)-2-(4-bromopyrazol-1-yl)propoxy]-tert-butyl-dimethylsilane |
| InChIKey | OFGDKZJOUCIMGF-SNVBAGLBSA-N |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)N1C=C(C=N1)Br |
Computed by PubChem (NCBI)