Products 2381984-86-5
CAS 2381984-86-5 is the registry number for tert-Butyl (3R,4R,5S)-4-(((benzyloxy)carbonyl)amino)-3-hydroxy-5-methylheptanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4R,5S)-3-hydroxy-5-methyl-4-(phenylmethoxycarbonylamino)heptanoate (CAS 2381984-86-5) is a chemical compound with the molecular formula C20H31NO5 and a molecular weight of 365.5 g/mol. IUPAC name: tert-butyl (3R,4R,5S)-3-hydroxy-5-methyl-4-(phenylmethoxycarbonylamino)heptanoate. InChIKey: AZTSBAWJROLRIQ-YXJHDRRASA-N.
| Molecular formula | C20H31NO5 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | tert-butyl (3R,4R,5S)-3-hydroxy-5-methyl-4-(phenylmethoxycarbonylamino)heptanoate |
| InChIKey | AZTSBAWJROLRIQ-YXJHDRRASA-N |
| SMILES | CC[C@H](C)[C@H]([C@@H](CC(=O)OC(C)(C)C)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)