CAS 2384598-55-2 is the registry number for METHYL 2-CHLORO-4-FORMYL-5-NITROBENZOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-chloro-4-formyl-5-nitrobenzoate (CAS 2384598-55-2) is a chemical compound with the molecular formula C9H6ClNO5 and a molecular weight of 243.60 g/mol. IUPAC name: methyl 2-chloro-4-formyl-5-nitrobenzoate. InChIKey: XUZYUYNEAUFGIV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO5 |
|---|---|
| Molecular weight | 243.60 g/mol |
| IUPAC name | methyl 2-chloro-4-formyl-5-nitrobenzoate |
| InChIKey | XUZYUYNEAUFGIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1)[N+](=O)[O-])C=O)Cl |
Computed by PubChem (NCBI)