Products 2384629-37-0
CAS 2384629-37-0 is the registry number for 4-Bromo-5-formylthiophene-3-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-5-formylthiophene-3-carboxylic acid (CAS 2384629-37-0) is a chemical compound with the molecular formula C6H3BrO3S and a molecular weight of 235.06 g/mol. IUPAC name: 4-bromo-5-formylthiophene-3-carboxylic acid. InChIKey: QSTNJAXIFDARJL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrO3S |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 4-bromo-5-formylthiophene-3-carboxylic acid |
| InChIKey | QSTNJAXIFDARJL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)C=O)Br)C(=O)O |
Computed by PubChem (NCBI)