Products 2389034-65-3
CAS 2389034-65-3 is the registry number for HCAIX-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-methoxyphenyl)urea (CAS 2389034-65-3) is a chemical compound with the molecular formula C16H17N7O4S and a molecular weight of 403.4 g/mol. IUPAC name: 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-methoxyphenyl)urea. InChIKey: LSVDQIASEPSKLW-UHFFFAOYSA-N.
| Molecular formula | C16H17N7O4S |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-methoxyphenyl)urea |
| InChIKey | LSVDQIASEPSKLW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)NC2=NN(C(=N2)N)C3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)