CAS 2390035-84-2 appears in our catalog under these names: Mycophenolic Acid Impurity 3, Mycophenolate Impurity 26, Mycophenolate Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[3-[(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]-2-methyloxiran-2-yl]propanoic acid (CAS 2390035-84-2) is a chemical compound with the molecular formula C17H20O7 and a molecular weight of 336.3 g/mol. IUPAC name: 3-[3-[(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]-2-methyloxiran-2-yl]propanoic acid. InChIKey: BAMWAQGTOOEQAF-UHFFFAOYSA-N.
| Molecular formula | C17H20O7 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 3-[3-[(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]-2-methyloxiran-2-yl]propanoic acid |
| InChIKey | BAMWAQGTOOEQAF-UHFFFAOYSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)CC3C(O3)(C)CCC(=O)O)O |
Computed by PubChem (NCBI)