CAS 2407555-63-7 is the registry number for 1,5-Dimethyl-8-azabicyclo(3.2.1)octan-3-one hemioxalate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Bis(1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-one);oxalic acid (CAS 2407555-63-7) is a chemical compound with the molecular formula C20H32N2O6 and a molecular weight of 396.5 g/mol. IUPAC name: bis(1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-one);oxalic acid. InChIKey: HQWVTLBUSNNOLT-UHFFFAOYSA-N.
| Molecular formula | C20H32N2O6 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | bis(1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-one);oxalic acid |
| InChIKey | HQWVTLBUSNNOLT-UHFFFAOYSA-N |
| SMILES | CC12CCC(N1)(CC(=O)C2)C.CC12CCC(N1)(CC(=O)C2)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)