Products 240815-53-6
CAS 240815-53-6 is the registry number for 2,6-Dichloroimidazo[1,5-a]pyrido[3,2-e]pyrazine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7,12-dichloro-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (CAS 240815-53-6) is a chemical compound with the molecular formula C9H4Cl2N4 and a molecular weight of 239.06 g/mol. IUPAC name: 7,12-dichloro-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene. InChIKey: MKUKWQYYNGRIOE-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N4 |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | 7,12-dichloro-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| InChIKey | MKUKWQYYNGRIOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(C3=CN=CN32)Cl)Cl |
Computed by PubChem (NCBI)