Products 2408503-84-2
CAS 2408503-84-2 is the registry number for 3-(5-(Chloromethyl)-3-methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[5-(chloromethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (CAS 2408503-84-2) is a chemical compound with the molecular formula C14H14ClN3O3 and a molecular weight of 307.73 g/mol. IUPAC name: 3-[5-(chloromethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione. InChIKey: OSWODZWUCSYBEZ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O3 |
|---|---|
| Molecular weight | 307.73 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| InChIKey | OSWODZWUCSYBEZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)CCl)N(C1=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)