CAS 2410542-66-2 is the registry number for 7-Methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2410542-66-2) is a chemical compound with the molecular formula C17H22BNO3 and a molecular weight of 299.2 g/mol. IUPAC name: 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: HZCUWAFQIMJJSD-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO3 |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | HZCUWAFQIMJJSD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2OC)N=C(C=C3)C |
Computed by PubChem (NCBI)