Products 2412197-49-8

CAS 2412197-49-8 is the registry number for 2-Amino-2-((S)-1,4-dioxan-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-2-(1,4-dioxan-2-yl)acetic acid (CAS 2412197-49-8) is a chemical compound with the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. IUPAC name: 2-amino-2-(1,4-dioxan-2-yl)acetic acid. InChIKey: FNWGTZOMEVZYAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO4
Molecular weight161.16 g/mol
IUPAC name2-amino-2-(1,4-dioxan-2-yl)acetic acid
InChIKeyFNWGTZOMEVZYAJ-UHFFFAOYSA-N
SMILESC1COC(CO1)C(C(=O)O)N

Computed by PubChem (NCBI)