Products 2413305-02-7
CAS 2413305-02-7 is the registry number for Tert-butyl 3-(2-benzothiazolylsulfonyl)-1-azetidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(1,3-benzothiazol-2-ylsulfonyl)azetidine-1-carboxylate (CAS 2413305-02-7) is a chemical compound with the molecular formula C15H18N2O4S2 and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl 3-(1,3-benzothiazol-2-ylsulfonyl)azetidine-1-carboxylate. InChIKey: MLDCQMYEGDPQNL-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4S2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl 3-(1,3-benzothiazol-2-ylsulfonyl)azetidine-1-carboxylate |
| InChIKey | MLDCQMYEGDPQNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)S(=O)(=O)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)