Products 2415967-06-3
CAS 2415967-06-3 is the registry number for Darolutamide Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl N-[(2S)-1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]carbamate (CAS 2415967-06-3) is a chemical compound with the molecular formula C18H21ClN4O2 and a molecular weight of 360.8 g/mol. IUPAC name: tert-butyl N-[(2S)-1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]carbamate. InChIKey: XFORCNZKSQSJBX-LBPRGKRZSA-N.
| Molecular formula | C18H21ClN4O2 |
|---|---|
| Molecular weight | 360.8 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]carbamate |
| InChIKey | XFORCNZKSQSJBX-LBPRGKRZSA-N |
| SMILES | C[C@@H](CN1C=CC(=N1)C2=CC(=C(C=C2)C#N)Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)