Products 2416992-75-9
CAS 2416992-75-9 is the registry number for tert-butyl (3R,4R)-3-amino-4-(fluoromethyl)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3R,4R)-3-amino-4-(fluoromethyl)pyrrolidine-1-carboxylate (CAS 2416992-75-9) is a chemical compound with the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-(fluoromethyl)pyrrolidine-1-carboxylate. InChIKey: QUKQPALDZPGNLB-SFYZADRCSA-N.
| Molecular formula | C10H19FN2O2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-(fluoromethyl)pyrrolidine-1-carboxylate |
| InChIKey | QUKQPALDZPGNLB-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)N)CF |
Computed by PubChem (NCBI)