Products 2417377-78-5
CAS 2417377-78-5 is the registry number for 3,6-Diethynyl-9-vinyl-9H-carbazole, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
9-ethenyl-3,6-diethynylcarbazole (CAS 2417377-78-5) is a chemical compound with the molecular formula C18H11N and a molecular weight of 241.3 g/mol. IUPAC name: 9-ethenyl-3,6-diethynylcarbazole. InChIKey: DRWHUYKDVMHFTF-UHFFFAOYSA-N.
| Molecular formula | C18H11N |
|---|---|
| Molecular weight | 241.3 g/mol |
| IUPAC name | 9-ethenyl-3,6-diethynylcarbazole |
| InChIKey | DRWHUYKDVMHFTF-UHFFFAOYSA-N |
| SMILES | C=CN1C2=C(C=C(C=C2)C#C)C3=C1C=CC(=C3)C#C |
Computed by PubChem (NCBI)