Products 2449213-57-2
CAS 2449213-57-2 is the registry number for (E)-LHF-535. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
2-[4-[(E)-2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]propan-2-ol (CAS 2449213-57-2) is a chemical compound with the molecular formula C27H28N2O2 and a molecular weight of 412.5 g/mol. IUPAC name: 2-[4-[(E)-2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]propan-2-ol. InChIKey: DBNZTRPIBJSUIX-AATRIKPKSA-N.
| Molecular formula | C27H28N2O2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 2-[4-[(E)-2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]propan-2-ol |
| InChIKey | DBNZTRPIBJSUIX-AATRIKPKSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)N2C=NC3=C2C=CC(=C3)/C=C/C4=CC=C(C=C4)C(C)(C)O |
Computed by PubChem (NCBI)