Products 2451917-23-8

CAS 2451917-23-8 is the registry number for 3-(2-(dimethylamino)ethyl)-1H-indol-4-yl trihydrogen diphosphate (Technical grade). Offered by: TRC. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] phosphono hydrogen phosphate (CAS 2451917-23-8) is a chemical compound with the molecular formula C12H18N2O7P2 and a molecular weight of 364.23 g/mol. IUPAC name: [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] phosphono hydrogen phosphate. InChIKey: XBSATDYCEAHWQU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N2O7P2
Molecular weight364.23 g/mol
IUPAC name[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] phosphono hydrogen phosphate
InChIKeyXBSATDYCEAHWQU-UHFFFAOYSA-N
SMILESCN(C)CCC1=CNC2=C1C(=CC=C2)OP(=O)(O)OP(=O)(O)O

Computed by PubChem (NCBI)