CAS 2451917-23-8 is the registry number for 3-(2-(dimethylamino)ethyl)-1H-indol-4-yl trihydrogen diphosphate (Technical grade). Offered by: TRC. Available pack sizes: 50mg.
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] phosphono hydrogen phosphate (CAS 2451917-23-8) is a chemical compound with the molecular formula C12H18N2O7P2 and a molecular weight of 364.23 g/mol. IUPAC name: [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] phosphono hydrogen phosphate. InChIKey: XBSATDYCEAHWQU-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O7P2 |
|---|---|
| Molecular weight | 364.23 g/mol |
| IUPAC name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] phosphono hydrogen phosphate |
| InChIKey | XBSATDYCEAHWQU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C(=CC=C2)OP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)