Products 2453324-54-2
CAS 2453324-54-2 appears in our catalog under these names: 1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-3-(3-fluorophenyl)azetidine-3-carboxylic acid, 95%, 95%, 1-Fmoc-3-(3-fluorophenyl)azetidine-3-carboxylic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
1-(9H-fluoren-9-ylmethoxycarbonyl)-3-(3-fluorophenyl)azetidine-3-carboxylic acid (CAS 2453324-54-2) is a chemical compound with the molecular formula C25H20FNO4 and a molecular weight of 417.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-(3-fluorophenyl)azetidine-3-carboxylic acid. InChIKey: UWFBHAQIDXIYFU-UHFFFAOYSA-N.
| Molecular formula | C25H20FNO4 |
|---|---|
| Molecular weight | 417.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-(3-fluorophenyl)azetidine-3-carboxylic acid |
| InChIKey | UWFBHAQIDXIYFU-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(C5=CC(=CC=C5)F)C(=O)O |
Computed by PubChem (NCBI)