CAS 2458817-56-4 is the registry number for 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-dibenzofurancarbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-carbonitrile (CAS 2458817-56-4) is a chemical compound with the molecular formula C19H18BNO3 and a molecular weight of 319.2 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-carbonitrile. InChIKey: LMDYJUHNKJRGGH-UHFFFAOYSA-N.
| Molecular formula | C19H18BNO3 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-3-carbonitrile |
| InChIKey | LMDYJUHNKJRGGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C4=C(O3)C=C(C=C4)C#N |
Computed by PubChem (NCBI)