CAS 2459230-54-5 is the registry number for 4-(2,5-Di(Hydrazinecarbonyl)-4-Hydroxyphenoxy)-N,N,N-Trimethylbutan-1-Aminium Chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2,5-bis(hydrazinecarbonyl)-4-hydroxyphenoxy]butyl-trimethylazanium chloride (CAS 2459230-54-5) is a chemical compound with the molecular formula C15H26ClN5O4 and a molecular weight of 375.85 g/mol. IUPAC name: 4-[2,5-bis(hydrazinecarbonyl)-4-hydroxyphenoxy]butyl-trimethylazanium chloride. InChIKey: LULFWPBASMCKCC-UHFFFAOYSA-N.
| Molecular formula | C15H26ClN5O4 |
|---|---|
| Molecular weight | 375.85 g/mol |
| IUPAC name | 4-[2,5-bis(hydrazinecarbonyl)-4-hydroxyphenoxy]butyl-trimethylazanium chloride |
| InChIKey | LULFWPBASMCKCC-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCCCOC1=CC(=C(C=C1C(=O)NN)O)C(=O)NN.[Cl-] |
Computed by PubChem (NCBI)