Products 2464919-09-1
CAS 2464919-09-1 is the registry number for tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole-9-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole-9-carboxylate (CAS 2464919-09-1) is a chemical compound with the molecular formula C23H28BNO4 and a molecular weight of 393.3 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole-9-carboxylate. InChIKey: PLWCWZNDEKOIFJ-UHFFFAOYSA-N.
| Molecular formula | C23H28BNO4 |
|---|---|
| Molecular weight | 393.3 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole-9-carboxylate |
| InChIKey | PLWCWZNDEKOIFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C4=CC=CC=C43)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)