Products 24789-52-4
CAS 24789-52-4 is the registry number for 4-(2,4-Dichlorophenoxy)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(2,4-dichlorophenoxy)benzonitrile (CAS 24789-52-4) is a chemical compound with the molecular formula C13H7Cl2NO and a molecular weight of 264.10 g/mol. IUPAC name: 4-(2,4-dichlorophenoxy)benzonitrile. InChIKey: ZZAIAUSRLITERQ-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2NO |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 4-(2,4-dichlorophenoxy)benzonitrile |
| InChIKey | ZZAIAUSRLITERQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)