CAS 2483830-59-5 is the registry number for Taurocholic acid-13C2,15N (sodium). Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
CAS 2483830-59-5 identifies a chemical compound with the molecular formula C26H45NNaO7S and a molecular weight of 541.7 g/mol. InChIKey: LHLYEKPSOJJBMK-NHBTVZSASA-N.
| Molecular formula | C26H45NNaO7S |
|---|---|
| Molecular weight | 541.7 g/mol |
| InChIKey | LHLYEKPSOJJBMK-NHBTVZSASA-N |
| SMILES | C[C@H](CCC(=O)[15NH][13CH2][13CH2]S(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C.[Na] |
Computed by PubChem (NCBI)