CAS 2489625-33-2 is the registry number for 1-(4-((Trimethylsilyl)ethynyl)phenyl)cyclopropane-1-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-[4-(2-trimethylsilylethynyl)phenyl]cyclopropane-1-carbonitrile (CAS 2489625-33-2) is a chemical compound with the molecular formula C15H17NSi and a molecular weight of 239.39 g/mol. IUPAC name: 1-[4-(2-trimethylsilylethynyl)phenyl]cyclopropane-1-carbonitrile. InChIKey: OOCCGAVOYNEFPQ-UHFFFAOYSA-N.
| Molecular formula | C15H17NSi |
|---|---|
| Molecular weight | 239.39 g/mol |
| IUPAC name | 1-[4-(2-trimethylsilylethynyl)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | OOCCGAVOYNEFPQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)C2(CC2)C#N |
Computed by PubChem (NCBI)