CAS 2504210-49-3 appears in our catalog under these names: Tofacitinib Impurity 164, Tofacitinib Impurity 220. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[(3S,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-chloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine (CAS 2504210-49-3) is a chemical compound with the molecular formula C20H24ClN5 and a molecular weight of 369.9 g/mol. IUPAC name: N-[(3S,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-chloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine. InChIKey: VAYZJJRLYDCAFB-RHSMWYFYSA-N.
| Molecular formula | C20H24ClN5 |
|---|---|
| Molecular weight | 369.9 g/mol |
| IUPAC name | N-[(3S,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-chloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| InChIKey | VAYZJJRLYDCAFB-RHSMWYFYSA-N |
| SMILES | C[C@@H]1CCN(C[C@H]1N(C)C2=NC3=C(C=CN3)C(=N2)Cl)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)