CAS 2519586-05-9 is the registry number for 3,9-Dibromopyrimido[1,2-b]indazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,9-dibromopyrimido[1,2-b]indazole (CAS 2519586-05-9) is a chemical compound with the molecular formula C10H5Br2N3 and a molecular weight of 326.97 g/mol. IUPAC name: 3,9-dibromopyrimido[1,2-b]indazole. InChIKey: SAXKRNXOODVVAQ-UHFFFAOYSA-N.
| Molecular formula | C10H5Br2N3 |
|---|---|
| Molecular weight | 326.97 g/mol |
| IUPAC name | 3,9-dibromopyrimido[1,2-b]indazole |
| InChIKey | SAXKRNXOODVVAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN3C=C(C=NC3=C2C=C1Br)Br |
Computed by PubChem (NCBI)