Products 2524718-73-6
CAS 2524718-73-6 is the registry number for LXQ-87. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one (CAS 2524718-73-6) is a chemical compound with the molecular formula C23H18Br2O5 and a molecular weight of 534.2 g/mol. IUPAC name: (E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one. InChIKey: CEFMFFITHQUXKR-LFYBBSHMSA-N.
| Molecular formula | C23H18Br2O5 |
|---|---|
| Molecular weight | 534.2 g/mol |
| IUPAC name | (E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one |
| InChIKey | CEFMFFITHQUXKR-LFYBBSHMSA-N |
| SMILES | CCOC1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)/C=C/C3=CC(=C(C(=C3Br)Br)O)O |
Computed by PubChem (NCBI)