Products 2530161-67-0
CAS 2530161-67-0 appears in our catalog under these names: HBC514/ 100%, HBC514. Offered by: TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-[(Z)-1-cyano-2-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethenyl]benzonitrile (CAS 2530161-67-0) is a chemical compound with the molecular formula C21H22N4 and a molecular weight of 330.4 g/mol. IUPAC name: 4-[(Z)-1-cyano-2-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethenyl]benzonitrile. InChIKey: BCLYGBLOTWSFBR-XSFVSMFZSA-N.
| Molecular formula | C21H22N4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 4-[(Z)-1-cyano-2-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethenyl]benzonitrile |
| InChIKey | BCLYGBLOTWSFBR-XSFVSMFZSA-N |
| SMILES | CN(C)CCN(C)C1=CC=C(C=C1)/C=C(\C#N)/C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)