CAS 25530-63-6 appears in our catalog under these names: Ammonium bismuth citrate, 95%, Ammonium bismuth citrate, Bi 48-52%, water ca 2% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 50g, 1kg, 250g, 1000g.
CAS 25530-63-6 identifies a chemical compound with the molecular formula C6H9BiNO7 and a molecular weight of 416.12 g/mol. InChIKey: XNDSNRGHJVSBHA-UHFFFAOYSA-L.
| Molecular formula | C6H9BiNO7 |
|---|---|
| Molecular weight | 416.12 g/mol |
| InChIKey | XNDSNRGHJVSBHA-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[NH4+].[Bi+2] |
Computed by PubChem (NCBI)