CAS 2561458-78-2 is the registry number for 2-Methyl-6-[3-(trimethylsilyl)phenyl]pyrido[3,2-d]pyrimidin-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-methyl-6-(3-trimethylsilylphenyl)pyrido[3,2-d]pyrimidin-4-amine (CAS 2561458-78-2) is a chemical compound with the molecular formula C17H20N4Si and a molecular weight of 308.5 g/mol. IUPAC name: 2-methyl-6-(3-trimethylsilylphenyl)pyrido[3,2-d]pyrimidin-4-amine. InChIKey: DCOMNCHHWKSAJA-UHFFFAOYSA-N.
| Molecular formula | C17H20N4Si |
|---|---|
| Molecular weight | 308.5 g/mol |
| IUPAC name | 2-methyl-6-(3-trimethylsilylphenyl)pyrido[3,2-d]pyrimidin-4-amine |
| InChIKey | DCOMNCHHWKSAJA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)N)N=C(C=C2)C3=CC(=CC=C3)[Si](C)(C)C |
Computed by PubChem (NCBI)