CAS 2561484-71-5 is the registry number for 7-(tert-Butyl) 2-methyl 4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7(1H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate (CAS 2561484-71-5) is a chemical compound with the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate. InChIKey: QDXITGXERJBCDE-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O5 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate |
| InChIKey | QDXITGXERJBCDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(NC2=O)C(=O)OC |
Computed by PubChem (NCBI)