CAS 2562-77-8 is the registry number for 1H-Benzimidazole,2-[1,1'-biphenyl]-4-yl-, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(4-phenylphenyl)-1H-benzimidazole (CAS 2562-77-8) is a chemical compound with the molecular formula C19H14N2 and a molecular weight of 270.3 g/mol. IUPAC name: 2-(4-phenylphenyl)-1H-benzimidazole. InChIKey: SAQHCMSUQDTMSF-UHFFFAOYSA-N.
| Molecular formula | C19H14N2 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 2-(4-phenylphenyl)-1H-benzimidazole |
| InChIKey | SAQHCMSUQDTMSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)