CAS 2566806-70-8 is the registry number for 4',5'-Bis(4-formylphenyl)-3',6'-dihydroxy-[1,1':2',1''-terphenyl]-4,4''-dicarbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2,4,5-tris(4-formylphenyl)-3,6-dihydroxyphenyl]benzaldehyde (CAS 2566806-70-8) is a chemical compound with the molecular formula C34H22O6 and a molecular weight of 526.5 g/mol. IUPAC name: 4-[2,4,5-tris(4-formylphenyl)-3,6-dihydroxyphenyl]benzaldehyde. InChIKey: KKISWACRIUCPBI-UHFFFAOYSA-N.
| Molecular formula | C34H22O6 |
|---|---|
| Molecular weight | 526.5 g/mol |
| IUPAC name | 4-[2,4,5-tris(4-formylphenyl)-3,6-dihydroxyphenyl]benzaldehyde |
| InChIKey | KKISWACRIUCPBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=C(C(=C(C(=C2O)C3=CC=C(C=C3)C=O)C4=CC=C(C=C4)C=O)O)C5=CC=C(C=C5)C=O |
Computed by PubChem (NCBI)