Products 2575547-29-2
CAS 2575547-29-2 appears in our catalog under these names: (R)–M8891, (R)-M8891, 98.67%, 98.67%, (R)-M8891, 98.67%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10 mg, 5 mg.
(3R)-N-[(3,5-difluorophenyl)methyl]-3-hydroxy-1-(1H-indol-5-yl)-2-oxopyrrolidine-3-carboxamide (CAS 2575547-29-2) is a chemical compound with the molecular formula C20H17F2N3O3 and a molecular weight of 385.4 g/mol. IUPAC name: (3R)-N-[(3,5-difluorophenyl)methyl]-3-hydroxy-1-(1H-indol-5-yl)-2-oxopyrrolidine-3-carboxamide. InChIKey: WVGGJQVCOTYFPV-HXUWFJFHSA-N.
| Molecular formula | C20H17F2N3O3 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (3R)-N-[(3,5-difluorophenyl)methyl]-3-hydroxy-1-(1H-indol-5-yl)-2-oxopyrrolidine-3-carboxamide |
| InChIKey | WVGGJQVCOTYFPV-HXUWFJFHSA-N |
| SMILES | C1CN(C(=O)[C@@]1(C(=O)NCC2=CC(=CC(=C2)F)F)O)C3=CC4=C(C=C3)NC=C4 |
Computed by PubChem (NCBI)