Products 2583190-29-6
CAS 2583190-29-6 is the registry number for 1-(4-chlorophenyl)-3-phenylpent-1-yn-3-ol, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-chlorophenyl)-3-phenylpent-1-yn-3-ol (CAS 2583190-29-6) is a chemical compound with the molecular formula C17H15ClO and a molecular weight of 270.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-phenylpent-1-yn-3-ol. InChIKey: CITCEXYUGPIVFG-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO |
|---|---|
| Molecular weight | 270.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-phenylpent-1-yn-3-ol |
| InChIKey | CITCEXYUGPIVFG-UHFFFAOYSA-N |
| SMILES | CCC(C#CC1=CC=C(C=C1)Cl)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)