Products 258843-62-8
CAS 258843-62-8 appears in our catalog under these names: Hoechst 33258 analog, 4-[3-[6-(4-Methyl-1-piperazinyl)[2,6'-bi-1H-benzimidazol]-2'-yl]phenoxy]butanoic acid, 99.96%, 99.96%, Hoechst 33258 analog, 99.78%. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 1mg, 5mg, 25mg, 10mg, 100 mg, 10mM/1mL.
4-[3-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanoic acid (CAS 258843-62-8) is a chemical compound with the molecular formula C29H30N6O3 and a molecular weight of 510.6 g/mol. IUPAC name: 4-[3-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanoic acid. InChIKey: QXQZJBBLMSBZHP-UHFFFAOYSA-N.
| Molecular formula | C29H30N6O3 |
|---|---|
| Molecular weight | 510.6 g/mol |
| IUPAC name | 4-[3-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanoic acid |
| InChIKey | QXQZJBBLMSBZHP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC(=CC=C6)OCCCC(=O)O |
Computed by PubChem (NCBI)