CAS 26054-46-6 is the registry number for (3aS,6aR)-rel-3,3a,6,6a-Tetrahydro-2H-cyclopenta[b]furan-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3aS,6aR)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one (CAS 26054-46-6) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. IUPAC name: (3aS,6aR)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one. InChIKey: RYBPGUMSFWGGLP-PHDIDXHHSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 124.14 g/mol |
| IUPAC name | (3aS,6aR)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| InChIKey | RYBPGUMSFWGGLP-PHDIDXHHSA-N |
| SMILES | C1C=C[C@H]2[C@@H]1OC(=O)C2 |
Computed by PubChem (NCBI)