Products 2626951-03-7
CAS 2626951-03-7 is the registry number for Methyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate (CAS 2626951-03-7) is a chemical compound with the molecular formula C13H19BO4S and a molecular weight of 282.2 g/mol. IUPAC name: methyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate. InChIKey: IPDVIYJOOLXTQA-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4S |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | methyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate |
| InChIKey | IPDVIYJOOLXTQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(S2)C)C(=O)OC |
Computed by PubChem (NCBI)