CAS 2639657-81-9 is the registry number for Tofacitinib Impurity 200. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 2639657-81-9) is a chemical compound with the molecular formula C16H25N5 and a molecular weight of 287.40 g/mol. IUPAC name: N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: LIWQUOLREJJFDP-OCCSQVGLSA-N.
| Molecular formula | C16H25N5 |
|---|---|
| Molecular weight | 287.40 g/mol |
| IUPAC name | N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | LIWQUOLREJJFDP-OCCSQVGLSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1N(C)C2=NC=NC3=C2C=CN3C(C)C |
Computed by PubChem (NCBI)