CAS 2640477-97-8 is the registry number for 1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)allyl)piperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidine (CAS 2640477-97-8) is a chemical compound with the molecular formula C14H26BNO2 and a molecular weight of 251.17 g/mol. IUPAC name: 1-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidine. InChIKey: KPJOTIIRPLPZDE-CMDGGOBGSA-N.
| Molecular formula | C14H26BNO2 |
|---|---|
| Molecular weight | 251.17 g/mol |
| IUPAC name | 1-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidine |
| InChIKey | KPJOTIIRPLPZDE-CMDGGOBGSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CN2CCCCC2 |
Computed by PubChem (NCBI)