CAS 2648642-22-0 is the registry number for Fmoc-L-Thz(Dmp)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g.
(4R)-2-(2,4-dimethoxyphenyl)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,3-thiazolidine-4-carboxylic acid (CAS 2648642-22-0) is a chemical compound with the molecular formula C27H25NO6S and a molecular weight of 491.6 g/mol. IUPAC name: (4R)-2-(2,4-dimethoxyphenyl)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: GUGPLCHASRHJOG-LFQPHHBNSA-N.
| Molecular formula | C27H25NO6S |
|---|---|
| Molecular weight | 491.6 g/mol |
| IUPAC name | (4R)-2-(2,4-dimethoxyphenyl)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | GUGPLCHASRHJOG-LFQPHHBNSA-N |
| SMILES | COC1=CC(=C(C=C1)C2N([C@@H](CS2)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)OC |
Computed by PubChem (NCBI)