Products 2653341-16-1
CAS 2653341-16-1 is the registry number for AIE-GA. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[(E)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]benzenesulfonamide (CAS 2653341-16-1) is a chemical compound with the molecular formula C33H25N3O2S and a molecular weight of 527.6 g/mol. IUPAC name: 4-[4-[(E)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]benzenesulfonamide. InChIKey: GYWVNTSLYWEUHB-FAJYDZGRSA-N.
| Molecular formula | C33H25N3O2S |
|---|---|
| Molecular weight | 527.6 g/mol |
| IUPAC name | 4-[4-[(E)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]benzenesulfonamide |
| InChIKey | GYWVNTSLYWEUHB-FAJYDZGRSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)/C=C(/C#N)\C4=CC=C(C=C4)C5=CC=C(C=C5)S(=O)(=O)N |
Computed by PubChem (NCBI)