Products 269401-43-6
CAS 269401-43-6 appears in our catalog under these names: S 0750 - FEW Chemicals, 787 nm in MeOH, 1 g, glass, S 0750 - FEW Chemicals, 787 nm in MeOH, 5 g, plastic, S 0750 - FEW Chemicals, 787 nm in MeOH, 10 g, plastic. Offered by: Roth. Available pack sizes: 1g, 5g, 10g.
1,3,3-trimethyl-2-[2-[2-phenylsulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole chloride (CAS 269401-43-6) is a chemical compound with the molecular formula C38H41ClN2S and a molecular weight of 593.3 g/mol. IUPAC name: 1,3,3-trimethyl-2-[2-[2-phenylsulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole chloride. InChIKey: OPURAYFFPVTDHH-UHFFFAOYSA-M.
| Molecular formula | C38H41ClN2S |
|---|---|
| Molecular weight | 593.3 g/mol |
| IUPAC name | 1,3,3-trimethyl-2-[2-[2-phenylsulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole chloride |
| InChIKey | OPURAYFFPVTDHH-UHFFFAOYSA-M |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1C=CC3=C(C(=CC=C4C(C5=CC=CC=C5N4C)(C)C)CCC3)SC6=CC=CC=C6)C)C.[Cl-] |
Computed by PubChem (NCBI)