CAS 2696258-07-6 is the registry number for rel-(3AR,6aR)-5-benzylhexahydro-2H-thieno[2,3-c]pyrrole 1,1-dioxide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aR,6aR)-5-benzyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide;hydrochloride (CAS 2696258-07-6) is a chemical compound with the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. IUPAC name: (3aR,6aR)-5-benzyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide;hydrochloride. InChIKey: AHJXEXYXKRQHFL-KZCZEQIWSA-N.
| Molecular formula | C13H18ClNO2S |
|---|---|
| Molecular weight | 287.81 g/mol |
| IUPAC name | (3aR,6aR)-5-benzyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide;hydrochloride |
| InChIKey | AHJXEXYXKRQHFL-KZCZEQIWSA-N |
| SMILES | C1CS(=O)(=O)[C@@H]2[C@H]1CN(C2)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)